EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O15 |
| Net Charge | 0 |
| Average Mass | 608.549 |
| Monoisotopic Mass | 608.17412 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc3o2)ccc1O |
| InChI | InChI=1S/C28H32O15/c1-10-21(33)23(35)25(37)27(39-10)43-26-24(36)22(34)19(9-29)42-28(26)40-12-6-14(31)20-15(32)8-16(41-18(20)7-12)11-3-4-13(30)17(5-11)38-2/h3-8,10,19,21-31,33-37H,9H2,1-2H3/t10-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | LGOQXEQWOCSLEC-CYZBKYQRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]chrysoeriol (CHEBI:75523) has functional parent 4',5,7-trihydroxy-3'-methoxyflavone (CHEBI:16514) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]chrysoeriol (CHEBI:75523) has role metabolite (CHEBI:25212) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]chrysoeriol (CHEBI:75523) is a dihydroxyflavone (CHEBI:38686) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]chrysoeriol (CHEBI:75523) is a disaccharide derivative (CHEBI:63353) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]chrysoeriol (CHEBI:75523) is a glycosyloxyflavone (CHEBI:50018) |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]chrysoeriol (CHEBI:75523) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| chrysoeriol 7-O-rhamnosylglucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7898742 | Reaxys |