EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34FN5O2 |
| Net Charge | 0 |
| Average Mass | 479.600 |
| Monoisotopic Mass | 479.26965 |
| SMILES | [H][C@@]12CC[C@@]3([H])N(C)C(=O)C(F)=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](C(=O)NCc3nc4cccnc4n3)CC[C@@]21[H] |
| InChI | InChI=1S/C27H34FN5O2/c1-26-11-10-17-15(6-9-21-27(17,2)13-19(28)25(35)33(21)3)16(26)7-8-18(26)24(34)30-14-22-31-20-5-4-12-29-23(20)32-22/h4-5,12-13,15-18,21H,6-11,14H2,1-3H3,(H,30,34)(H,29,31,32)/t15-,16-,17-,18+,21+,26-,27+/m0/s1 |
| InChIKey | GBEUKTWTUSPHEE-JWJWXJQQSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-0773 (CHEBI:755228) has role androgen (CHEBI:50113) |
| mk-0773 (CHEBI:755228) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| Mk-0773 | ChEMBL |
| PF-05314882 | ChEMBL |
| Citations |
|---|