EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16FN3O3 |
| Net Charge | 0 |
| Average Mass | 341.342 |
| Monoisotopic Mass | 341.11757 |
| SMILES | COc1cc(F)ccc1Cn1ccc2c3c(ncc21)C(=O)N(O)CC3 |
| InChI | InChI=1S/C18H16FN3O3/c1-25-16-8-12(19)3-2-11(16)10-21-6-4-13-14-5-7-22(24)18(23)17(14)20-9-15(13)21/h2-4,6,8-9,24H,5,7,10H2,1H3 |
| InChIKey | OYKZKGBMHATGTA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-04776548 (CHEBI:755226) has role anti-HIV agent (CHEBI:64946) |
| pf-04776548 (CHEBI:755226) is a naphthyridine derivative (CHEBI:73539) |
| Synonyms | Source |
|---|---|
| PF-04776548 | ChEMBL |
| PF-4776548 | ChEMBL |