EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N6O5 |
| Net Charge | 0 |
| Average Mass | 478.509 |
| Monoisotopic Mass | 478.19647 |
| SMILES | COC[C@H](C)Oc1cc(Oc2cnc(C(=O)N3CCC3)cn2)cc(C(=O)Nc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C24H26N6O5/c1-15-10-27-21(12-25-15)29-23(31)17-7-18(34-16(2)14-33-3)9-19(8-17)35-22-13-26-20(11-28-22)24(32)30-5-4-6-30/h7-13,16H,4-6,14H2,1-3H3,(H,27,29,31)/t16-/m0/s1 |
| InChIKey | FJEJHJINOKKDCW-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-1656 (CHEBI:755225) has role antiviral agent (CHEBI:22587) |
| azd-1656 (CHEBI:755225) has role hypoglycemic agent (CHEBI:35526) |
| azd-1656 (CHEBI:755225) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Azd 1656 | ChEMBL |
| Azd-1656 | ChEMBL |
| AZD1656 | ChEMBL |
| Citations |
|---|