EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N5O4 |
| Net Charge | 0 |
| Average Mass | 441.532 |
| Monoisotopic Mass | 441.23760 |
| SMILES | Cc1ncnc1CN1CCN(C(=O)N[C@@H](CC(C)C)C(=O)O)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H31N5O4/c1-15(2)11-18(22(30)31)26-23(32)28-10-9-27(13-19-16(3)24-14-25-19)21(29)20(28)12-17-7-5-4-6-8-17/h4-8,14-15,18,20H,9-13H2,1-3H3,(H,24,25)(H,26,32)(H,30,31)/t18-,20-/m0/s1 |
| InChIKey | COLCNDRDBCLVOC-ICSRJNTNSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ggti-2418 (CHEBI:755223) has role antineoplastic agent (CHEBI:35610) |
| ggti-2418 (CHEBI:755223) is a leucine derivative (CHEBI:47003) |
| Synonyms | Source |
|---|---|
| Ggti-2418 | ChEMBL |
| Ptx-100 | ChEMBL |
| Citations |
|---|