EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22F3N3O3 |
| Net Charge | 0 |
| Average Mass | 433.430 |
| Monoisotopic Mass | 433.16133 |
| SMILES | Cc1c(Cn2c(C)nc3c(C(=O)O)cc(N4CCOCC4)cc32)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H22F3N3O3/c1-13-15(4-3-5-18(13)22(23,24)25)12-28-14(2)26-20-17(21(29)30)10-16(11-19(20)28)27-6-8-31-9-7-27/h3-5,10-11H,6-9,12H2,1-2H3,(H,29,30) |
| InChIKey | XTKLTGBKIDQGQL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-2636771 (CHEBI:755218) has role antineoplastic agent (CHEBI:35610) |
| gsk-2636771 (CHEBI:755218) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| Synonyms | Source |
|---|---|
| Gsk 2636771 | ChEMBL |
| Gsk-2636771 | ChEMBL |
| GSK2636771 | ChEMBL |
| Citations |
|---|