EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C19H22N2.HCl |
| Net Charge | 0 |
| Average Mass | 332.875 |
| Monoisotopic Mass | 332.16554 |
| SMILES | Cc1ccc(/C(=C\CN2CCCC2)c2ccccn2)cc1.Cl.O |
| InChI | InChI=1S/C19H22N2.ClH.H2O/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21;;/h2-3,6-12H,4-5,13-15H2,1H3;1H;1H2/b18-11+;; |
| InChIKey | CUZMOIXUFHOLLN-UMVVUDSKSA-N |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triprolidine hydrochloride (CHEBI:755216) has role nasal decongestant (CHEBI:77715) |
| triprolidine hydrochloride (CHEBI:755216) is a toluenes (CHEBI:27024) |
| Synonyms | Source |
|---|---|
| NSC-757361 | ChEMBL |
| Triprolidine hydrochloride hydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Myidyl | ChEMBL |
| Triprolidine hydrochloride component of actahist | ChEMBL |
| Triprolidine hydrochloride component of actifed | ChEMBL |
| Triprolidine hydrochloride component of allerfed | ChEMBL |
| Triprolidine hydrochloride component of corphed | ChEMBL |
| Triprolidine hydrochloride component of histafed | ChEMBL |