EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O5S |
| Net Charge | 0 |
| Average Mass | 432.542 |
| Monoisotopic Mass | 432.17189 |
| SMILES | [H][C@]12CCC[C@@H](C(=O)O)N1C(=O)[C@@H](NC(=O)[C@@H](SC(C)=O)C(C)C)Cc1ccccc12 |
| InChI | InChI=1S/C22H28N2O5S/c1-12(2)19(30-13(3)25)20(26)23-16-11-14-7-4-5-8-15(14)17-9-6-10-18(22(28)29)24(17)21(16)27/h4-5,7-8,12,16-19H,6,9-11H2,1-3H3,(H,23,26)(H,28,29)/t16-,17+,18-,19-/m0/s1 |
| InChIKey | FXKFFTMLFPWYFH-RDGPPVDQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilepatril (CHEBI:755214) has role antihypertensive agent (CHEBI:35674) |
| ilepatril (CHEBI:755214) is a peptide (CHEBI:16670) |
| INNs | Source |
|---|---|
| ilepatril | WHO MedNet |
| ilepatrilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| AVE-7688 | ChEMBL |
| AVE7688 | ChEMBL |