EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22O2 |
| Net Charge | 0 |
| Average Mass | 186.295 |
| Monoisotopic Mass | 186.16198 |
| SMILES | CCCCCC[C@@H](CCC)C(=O)O |
| InChI | InChI=1S/C11H22O2/c1-3-5-6-7-9-10(8-4-2)11(12)13/h10H,3-9H2,1-2H3,(H,12,13)/t10-/m1/s1 |
| InChIKey | YCYMCMYLORLIJX-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arundic acid (CHEBI:755213) has role antiparkinson drug (CHEBI:48407) |
| arundic acid (CHEBI:755213) is a medium-chain fatty acid (CHEBI:59554) |
| INNs | Source |
|---|---|
| acide arundique | WHO MedNet |
| acido arundico | WHO MedNet |
| arundic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-0724 | ChEMBL |
| MK0724 | ChEMBL |
| Ono-2506 | ChEMBL |
| ONO-2506PO | ChEMBL |