EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23Cl2N3OS |
| Net Charge | 0 |
| Average Mass | 448.419 |
| Monoisotopic Mass | 447.09389 |
| SMILES | CN1CCN(c2ccccc2/C=C2\SCCN(c3ccc(Cl)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H23Cl2N3OS/c1-25-8-10-26(11-9-25)20-5-3-2-4-16(20)14-21-22(28)27(12-13-29-21)17-6-7-18(23)19(24)15-17/h2-7,14-15H,8-13H2,1H3/b21-14- |
| InChIKey | LHYMPSWMHXUWSK-STZFKDTASA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elzasonan (CHEBI:755206) has role antidepressant (CHEBI:35469) |
| elzasonan (CHEBI:755206) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| elzasonan | WHO MedNet |
| Citations |
|---|