EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755197 - troxerutin
| Formula | C33H42O19 |
| Net Charge | 0 |
| Average Mass | 742.680 |
| Monoisotopic Mass | 742.23203 |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3c(-c4ccc(OCCO)c(OCCO)c4)oc4cc(OCCO)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H42O19/c1-14-23(38)26(41)28(43)32(49-14)48-13-21-24(39)27(42)29(44)33(51-21)52-31-25(40)22-17(37)11-16(45-7-4-34)12-20(22)50-30(31)15-2-3-18(46-8-5-35)19(10-15)47-9-6-36/h2-3,10-12,14,21,23-24,26-29,32-39,41-44H,4-9,13H2,1H3/t14-,21+,23-,24+,26+,27-,28+,29+,32+,33-/m0/s1 |
| InChIKey | IYVFNTXFRYQLRP-VVSTWUKXSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| troxerutin (CHEBI:755197) has role anti-inflammatory agent (CHEBI:67079) |
| troxerutin (CHEBI:755197) has role cardiovascular drug (CHEBI:35554) |
| troxerutin (CHEBI:755197) is a flavonoids (CHEBI:72544) |
| troxerutin (CHEBI:755197) is a glycoside (CHEBI:24400) |
| INN | Source |
|---|---|
| troxerutina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3',4',7-tris(hydroxyethyl)rutin | ChEMBL |
| NSC-758937 | ChEMBL |
| Z 6000 | ChEMBL |
| Z-6000 | ChEMBL |
| Citations |
|---|