EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C23H28ClN5O3.HCl |
| Net Charge | 0 |
| Average Mass | 530.884 |
| Monoisotopic Mass | 529.14142 |
| SMILES | CN1CCN(CCCCN2C(=O)CN(/N=C/c3ccc(-c4ccc(Cl)cc4)o3)C2=O)CC1.Cl.Cl |
| InChI | InChI=1S/C23H28ClN5O3.2ClH/c1-26-12-14-27(15-13-26)10-2-3-11-28-22(30)17-29(23(28)31)25-16-20-8-9-21(32-20)18-4-6-19(24)7-5-18;;/h4-9,16H,2-3,10-15,17H2,1H3;2*1H/b25-16+;; |
| InChIKey | HHPSICLSNHCSNZ-BYEGLACWSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azimilide dihydrochloride (CHEBI:755193) has role anti-arrhythmia drug (CHEBI:38070) |
| azimilide dihydrochloride (CHEBI:755193) is a imidazolidine-2,4-dione (CHEBI:24628) |
| Synonym | Source |
|---|---|
| NE-10064 | ChEMBL |
| Citations |
|---|