EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755192 - ethambutol hydrochloride
| Formula | HCl.C10H24N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 277.236 |
| Monoisotopic Mass | 276.13713 |
| SMILES | CC[C@@H](CO)NCCN[C@@H](CC)CO.Cl.Cl |
| InChI | InChI=1S/C10H24N2O2.2ClH/c1-3-9(7-13)11-5-6-12-10(4-2)8-14;;/h9-14H,3-8H2,1-2H3;2*1H/t9-,10-;;/m0../s1 |
| InChIKey | AUAHHJJRFHRVPV-BZDVOYDHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethambutol hydrochloride (CHEBI:755192) has role anti-HIV agent (CHEBI:64946) |
| ethambutol hydrochloride (CHEBI:755192) has role antibacterial agent (CHEBI:33282) |
| ethambutol hydrochloride (CHEBI:755192) has role antitubercular agent (CHEBI:33231) |
| ethambutol hydrochloride (CHEBI:755192) is a secondary amino compound (CHEBI:50995) |
| Synonyms | Source |
|---|---|
| CL 40881 | ChEMBL |
| CL-40881 | ChEMBL |
| Dadibutol | ChEMBL |
| Dexambutol | ChEMBL |
| Ebutol | ChEMBL |
| Etapiam | ChEMBL |
| Brand Names | Source |
|---|---|
| Myambutol | ChEMBL |
| Mynah 200 | ChEMBL |
| Mynah 250 | ChEMBL |
| Mynah 300 | ChEMBL |
| Mynah 365 | ChEMBL |
| Citations |
|---|