EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClN6O |
| Net Charge | 0 |
| Average Mass | 426.952 |
| Monoisotopic Mass | 426.19349 |
| SMILES | Cc1nc(N2CCN(C)CC2)c2nc(-c3ccccc3Cl)n(C3CCOCC3)c2n1 |
| InChI | InChI=1S/C22H27ClN6O/c1-15-24-21(28-11-9-27(2)10-12-28)19-22(25-15)29(16-7-13-30-14-8-16)20(26-19)17-5-3-4-6-18(17)23/h3-6,16H,7-14H2,1-2H3 |
| InChIKey | UCMNDPDJRSEZPL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly2828360 (CHEBI:755190) has role anti-inflammatory agent (CHEBI:67079) |
| ly2828360 (CHEBI:755190) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| LY-2828360 | ChEMBL |
| LY2828360 | ChEMBL |
| Citations |
|---|