EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5.C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 278.261 |
| Monoisotopic Mass | 278.11140 |
| SMILES | NCCC[C@H](N)C(=O)O.O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.C5H6O5/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);1-2H2,(H,7,8)(H,9,10)/t4-;/m0./s1 |
| InChIKey | SLPUVFBNQHVEEU-WCCKRBBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornithine oxoglurate (CHEBI:755187) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| .alpha.-ketoglutaric acid compound with l(+)-ornithine | ChEMBL |
| Cetornan | ChEMBL |
| Ornicetil | ChEMBL |
| Ornithine .alpha.-ketoglutarate | ChEMBL |
| Ornithine monoxoglurate | ChEMBL |
| Ornithine oxoglurate | ChEMBL |
| Citations |
|---|