EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C20H22O4.Na |
| Net Charge | 0 |
| Average Mass | 372.372 |
| Monoisotopic Mass | 372.13135 |
| SMILES | CC(/C=C/C=C(\C)C(=O)[O-])=C\C=C\C=C(C)\C=C\C=C(/C)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H24O4.2Na/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24;;/h5-14H,1-4H3,(H,21,22)(H,23,24);;/q;2*+1/p-2/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+;; |
| InChIKey | RMDMBHQVNHQDDD-VFWKRBOSSA-L |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| transcrocetinate sodium (CHEBI:755162) has role antineoplastic agent (CHEBI:35610) |
| transcrocetinate sodium (CHEBI:755162) has role antiviral agent (CHEBI:22587) |
| transcrocetinate sodium (CHEBI:755162) is a diterpenoid (CHEBI:23849) |
| Synonyms | Source |
|---|---|
| Disodium trans-crocetinate | ChEMBL |
| Transcrocetinate sodium | ChEMBL |
| Trans sodium crocetinate | ChEMBL |