EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17F3N2O4S |
| Net Charge | 0 |
| Average Mass | 426.416 |
| Monoisotopic Mass | 426.08611 |
| SMILES | Cc1c(CC(=O)O)c2cccnc2n1Cc1ccc(S(C)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O4S/c1-11-15(9-17(25)26)14-4-3-7-23-18(14)24(11)10-12-5-6-13(29(2,27)28)8-16(12)19(20,21)22/h3-8H,9-10H2,1-2H3,(H,25,26) |
| InChIKey | GFPPXZDRVCSVNR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fevipiprant (CHEBI:755160) has role anti-asthmatic agent (CHEBI:65023) |
| fevipiprant (CHEBI:755160) has role dermatologic drug (CHEBI:50177) |
| fevipiprant (CHEBI:755160) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| fevipiprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| NVP-QAW039 | ChEMBL |
| QAW-039 | ChEMBL |
| QAW039 | ChEMBL |
| Citations |
|---|