EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21F3N8O3S |
| Net Charge | 0 |
| Average Mass | 510.502 |
| Monoisotopic Mass | 510.14094 |
| SMILES | CNC(=O)c1ccc(Nc2ncc(C(F)(F)F)c(NCc3nccnc3N(C)S(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C20H21F3N8O3S/c1-24-18(32)12-4-6-13(7-5-12)29-19-28-10-14(20(21,22)23)16(30-19)27-11-15-17(26-9-8-25-15)31(2)35(3,33)34/h4-10H,11H2,1-3H3,(H,24,32)(H2,27,28,29,30) |
| InChIKey | FWLMVFUGMHIOAA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| defactinib (CHEBI:755159) has role antineoplastic agent (CHEBI:35610) |
| defactinib (CHEBI:755159) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| defactinib | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-04554878 | ChEMBL |
| Citations |
|---|