EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | K.C16H17N3O5.H |
| Net Charge | 0 |
| Average Mass | 371.434 |
| Monoisotopic Mass | 371.08835 |
| SMILES | N[C@H](CCC(=O)N[C@H](Cc1cnc2ccccc12)C(=O)[O-])C(=O)[O-].[H+].[K+] |
| InChI | InChI=1S/C16H19N3O5.K/c17-11(15(21)22)5-6-14(20)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12;/h1-4,8,11,13,18H,5-7,17H2,(H,19,20)(H,21,22)(H,23,24);/q;+1/p-1/t11-,13-;/m1./s1 |
| InChIKey | JBUWHGCMOSDECA-LOCPCMAASA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orilotimod potassium (CHEBI:755157) has role antipsoriatic (CHEBI:50748) |
| orilotimod potassium (CHEBI:755157) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Apo805K1 | ChEMBL |
| APO-805K1 | ChEMBL |
| Orilotimod potassium | ChEMBL |