EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | [H][C@]1([C@H](O)[C@H](O)[C@]2([H])CO2)CO1 |
| InChI | InChI=1S/C6H10O4/c7-5(3-1-9-3)6(8)4-2-10-4/h3-8H,1-2H2/t3-,4+,5+,6- |
| InChIKey | AAFJXZWCNVJTMK-GUCUJZIJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dianhydrogalactitol (CHEBI:755152) has role antineoplastic agent (CHEBI:35610) |
| dianhydrogalactitol (CHEBI:755152) is a polyol (CHEBI:26191) |
| INNs | Source |
|---|---|
| dianhidrogalactitol | WHO MedNet |
| dianhydrogalactitol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,2:5,6-dianhdrogalactitol | ChEMBL |
| 1,2:5,6-dianhydrogalactitol | ChEMBL |
| Dulcitol diepoxide | ChEMBL |
| NSC-132313 | ChEMBL |
| NSC-1323313 | ChEMBL |
| VAL-083 | ChEMBL |