EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755148 - fosdagrocorat
| Formula | C29H30F3N2O5P |
| Net Charge | 0 |
| Average Mass | 574.536 |
| Monoisotopic Mass | 574.18444 |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](OP(=O)(O)O)(C(F)(F)F)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C29H30F3N2O5P/c1-19-25(8-5-15-33-19)34-26(35)22-10-12-24-21(16-22)9-11-23-18-28(29(30,31)32,39-40(36,37)38)14-13-27(23,24)17-20-6-3-2-4-7-20/h2-8,10,12,15-16,23H,9,11,13-14,17-18H2,1H3,(H,34,35)(H2,36,37,38)/t23-,27+,28-/m1/s1 |
| InChIKey | BVXLAHSJXXSWFF-KEKPKEOLSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosdagrocorat (CHEBI:755148) has role antirheumatic drug (CHEBI:35842) |
| fosdagrocorat (CHEBI:755148) is a phenanthrenes (CHEBI:25961) |
| INN | Source |
|---|---|
| fosdagrocorat | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-04171327 | ChEMBL |