EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O5 |
| Net Charge | 0 |
| Average Mass | 398.499 |
| Monoisotopic Mass | 398.20932 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)[C@@H](C)CC#CC)[C@@]1([H])c1cccc(CCCC(=O)O)c1O2 |
| InChI | InChI=1S/C24H30O5/c1-3-4-7-15(2)19(25)13-12-17-20(26)14-21-23(17)18-10-5-8-16(24(18)29-21)9-6-11-22(27)28/h5,8,10,12-13,15,17,19-21,23,25-26H,6-7,9,11,14H2,1-2H3,(H,27,28)/b13-12+/t15-,17-,19+,20+,21-,23-/m0/s1 |
| InChIKey | CTPOHARTNNSRSR-NOQAJONNSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esuberaprost (CHEBI:755146) has role antihypertensive agent (CHEBI:35674) |
| esuberaprost (CHEBI:755146) is a aliphatic alcohol (CHEBI:2571) |
| INN | Source |
|---|---|
| esuberaprost | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aps-314d | ChEMBL |
| Aps-314d free acid | ChEMBL |
| BPS-314d | ChEMBL |