EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H29F3N2O2 |
| Net Charge | 0 |
| Average Mass | 494.557 |
| Monoisotopic Mass | 494.21811 |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(C(F)(F)F)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C29H29F3N2O2/c1-19-25(8-5-15-33-19)34-26(35)22-10-12-24-21(16-22)9-11-23-18-28(36,29(30,31)32)14-13-27(23,24)17-20-6-3-2-4-7-20/h2-8,10,12,15-16,23,36H,9,11,13-14,17-18H2,1H3,(H,34,35)/t23-,27+,28-/m1/s1 |
| InChIKey | QJJBNCHSWFGXML-KEKPKEOLSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dagrocorat (CHEBI:755139) is a phenanthrenes (CHEBI:25961) |
| INN | Source |
|---|---|
| dagrocorat | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-00251802 | ChEMBL |
| PF-0251802 | ChEMBL |
| PF-802 | ChEMBL |
| Citations |
|---|