EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C19H21O10PS.Na |
| Net Charge | 0 |
| Average Mass | 518.388 |
| Monoisotopic Mass | 518.03884 |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OP(=O)([O-])[O-])c2)c(OC)c1.[Na+].[Na+] |
| InChI | InChI=1S/C19H23O10PS.2Na/c1-25-14-10-17(27-3)15(18(11-14)28-4)7-8-31(23,24)12-13-5-6-16(26-2)19(9-13)29-30(20,21)22;;/h5-11H,12H2,1-4H3,(H2,20,21,22);;/q;2*+1/p-2/b8-7+;; |
| InChIKey | MIBWXNAYNGADJD-MIIBGCIDSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| briciclib sodium (CHEBI:755138) has role antineoplastic agent (CHEBI:35610) |
| briciclib sodium (CHEBI:755138) is a aryl phosphate (CHEBI:36943) |
| Synonyms | Source |
|---|---|
| Briciclib sodium | ChEMBL |
| ON 013105 | ChEMBL |
| ON013105 | ChEMBL |