EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755136 - leq506
| Formula | C25H32N6O |
| Net Charge | 0 |
| Average Mass | 432.572 |
| Monoisotopic Mass | 432.26376 |
| SMILES | Cc1c(Cc2ccccc2)nnc(N2CCN(c3cnc(C(C)(C)O)cn3)[C@H](C)C2)c1C |
| InChI | InChI=1S/C25H32N6O/c1-17-16-30(11-12-31(17)23-15-26-22(14-27-23)25(4,5)32)24-19(3)18(2)21(28-29-24)13-20-9-7-6-8-10-20/h6-10,14-15,17,32H,11-13,16H2,1-5H3/t17-/m1/s1 |
| InChIKey | POERAARDVFVDLO-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leq506 (CHEBI:755136) has role antineoplastic agent (CHEBI:35610) |
| leq506 (CHEBI:755136) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Leq 506 | ChEMBL |
| LEQ-506 | ChEMBL |
| LEQ506 | ChEMBL |
| Nvp-leq-506 | ChEMBL |
| NVP-LEQ506 | ChEMBL |
| Citations |
|---|