EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755135 - obp-801
| Formula | C20H31N3O6S2 |
| Net Charge | 0 |
| Average Mass | 473.617 |
| Monoisotopic Mass | 473.16543 |
| SMILES | CC(C)[C@H]1NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](C)C(=O)N2)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C20H31N3O6S2/c1-11(2)18-15(24)9-17(26)29-13-6-4-5-7-30-31-10-14(20(28)23-18)22-19(27)12(3)21-16(25)8-13/h4,6,11-15,18,24H,5,7-10H2,1-3H3,(H,21,25)(H,22,27)(H,23,28)/b6-4+/t12-,13-,14-,15+,18-/m1/s1 |
| InChIKey | XFLBOEMFLGLWFF-HDXRNPEWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obp-801 (CHEBI:755135) has role antineoplastic agent (CHEBI:35610) |
| obp-801 (CHEBI:755135) is a cyclodepsipeptide (CHEBI:35213) |
| Synonyms | Source |
|---|---|
| Obp-801 | ChEMBL |
| Spiruchostatin a | ChEMBL |
| YM-753 | ChEMBL |
| Citations |
|---|