EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35Cl2NO5S |
| Net Charge | 0 |
| Average Mass | 568.563 |
| Monoisotopic Mass | 567.16130 |
| SMILES | CC(C)[C@@H](CS(=O)(=O)C(C)C)N1C(=O)[C@@](C)(CC(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H35Cl2NO5S/c1-17(2)24(16-37(35,36)18(3)4)31-26(19-9-11-21(29)12-10-19)23(20-7-6-8-22(30)13-20)14-28(5,27(31)34)15-25(32)33/h6-13,17-18,23-24,26H,14-16H2,1-5H3,(H,32,33)/t23-,24-,26-,28-/m1/s1 |
| InChIKey | DRLCSJFKKILATL-YWCVFVGNSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| navtemadlin (CHEBI:755133) has role antifibrotic agent (CHEBI:233423) |
| navtemadlin (CHEBI:755133) has role antineoplastic agent (CHEBI:35610) |
| navtemadlin (CHEBI:755133) is a stilbenoid (CHEBI:26776) |
| INN | Source |
|---|---|
| navtemadlin | WHO MedNet |
| Synonyms | Source |
|---|---|
| AMG 232 | ChEMBL |
| AMG-232 | ChEMBL |
| KRT-232 | ChEMBL |
| Mdm2 inhibitor amg-232 | ChEMBL |
| Citations |
|---|