EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16F3N7 |
| Net Charge | 0 |
| Average Mass | 339.325 |
| Monoisotopic Mass | 339.14193 |
| SMILES | CNc1nc(Nc2cn(C(C)(C)C#N)nc2C)ncc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N7/c1-8-10(6-24(23-8)13(2,3)7-18)21-12-20-5-9(14(15,16)17)11(19-4)22-12/h5-6H,1-4H3,(H2,19,20,21,22) |
| InChIKey | ZPPUMAMZIMPJGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dnl-201 (CHEBI:755132) has role antiparkinson drug (CHEBI:48407) |
| dnl-201 (CHEBI:755132) is a secondary amine (CHEBI:32863) |
| Synonyms | Source |
|---|---|
| Dnl-201 | ChEMBL |
| Dnl201 | ChEMBL |
| GNE-0877 | ChEMBL |
| Citations |
|---|