EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H50N8O6 |
| Net Charge | 0 |
| Average Mass | 762.912 |
| Monoisotopic Mass | 762.38533 |
| SMILES | [H][C@@]1(c2ncc(-c3ccc4cc(-c5ccc6nc([C@]7([H])CCCN7C(=O)[C@@]([H])(NC(=O)OC)C(C)C)nc6c5)ccc4c3)n2)CCCN1C(=O)[C@@]([H])(NC(=O)OC)C(C)C |
| InChI | InChI=1S/C42H50N8O6/c1-23(2)35(47-41(53)55-5)39(51)49-17-7-9-33(49)37-43-22-32(46-37)29-14-13-25-19-26(11-12-27(25)20-29)28-15-16-30-31(21-28)45-38(44-30)34-10-8-18-50(34)40(52)36(24(3)4)48-42(54)56-6/h11-16,19-24,33-36H,7-10,17-18H2,1-6H3,(H,43,46)(H,44,45)(H,47,53)(H,48,54)/t33-,34-,35-,36-/m0/s1 |
| InChIKey | LCHMHYPWGWYXEL-ZYADHFCISA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ravidasvir (CHEBI:755131) has role antiviral agent (CHEBI:22587) |
| ravidasvir (CHEBI:755131) is a valine derivative (CHEBI:27267) |
| Synonyms | Source |
|---|---|
| BI 238630 | ChEMBL |
| BI-238630 | ChEMBL |
| C5 | ChEMBL |
| PPI-668 free base | ChEMBL |
| Ravidasvir | ChEMBL |
| Citations |
|---|