EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755130 - radalbuvir
| Formula | C30H41NO6S |
| Net Charge | 0 |
| Average Mass | 543.726 |
| Monoisotopic Mass | 543.26546 |
| SMILES | CC1=CC[C@H](C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)[C@H]2CC[C@](O)(CO[C@H]3CCOC3)CC2)CC1 |
| InChI | InChI=1S/C30H41NO6S/c1-20-5-7-21(8-6-20)27(32)31(25-17-24(11-13-29(2,3)4)38-26(25)28(33)34)22-9-14-30(35,15-10-22)19-37-23-12-16-36-18-23/h5,17,21-23,35H,6-10,12,14-16,18-19H2,1-4H3,(H,33,34)/t21-,22-,23-,30+/m0/s1 |
| InChIKey | MUICUPWICXUNRS-GDCCIXDYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| radalbuvir (CHEBI:755130) has role antiviral agent (CHEBI:22587) |
| radalbuvir (CHEBI:755130) is a thiophenecarboxylic acid (CHEBI:48436) |
| INN | Source |
|---|---|
| radalbuvir | WHO MedNet |
| Synonym | Source |
|---|---|
| Gs-9669 | ChEMBL |
| Citations |
|---|