EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N6O3 |
| Net Charge | 0 |
| Average Mass | 406.446 |
| Monoisotopic Mass | 406.17534 |
| SMILES | COc1cccc2cc(-c3nc([C@H]4CC[C@H](C(=O)O)CC4)n4ncnc(N)c34)nc12 |
| InChI | InChI=1S/C21H22N6O3/c1-30-15-4-2-3-13-9-14(25-16(13)15)17-18-19(22)23-10-24-27(18)20(26-17)11-5-7-12(8-6-11)21(28)29/h2-4,9-12,25H,5-8H2,1H3,(H,28,29)(H2,22,23,24)/t11-,12- |
| InChIKey | JROFGZPOBKIAEW-HAQNSBGRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osi-027 (CHEBI:755128) has role antineoplastic agent (CHEBI:35610) |
| osi-027 (CHEBI:755128) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| AEVI-006 | ChEMBL |
| ASP 7486 | ChEMBL |
| ASP-7486 | ChEMBL |
| ASP7486 | ChEMBL |
| CERC 006 | ChEMBL |
| CERC-006 | ChEMBL |
| Citations |
|---|