EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N7O |
| Net Charge | 0 |
| Average Mass | 429.528 |
| Monoisotopic Mass | 429.22771 |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(C#N)c(=O)n(C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C24H27N7O/c1-29-10-12-30(13-11-29)20-8-6-19(7-9-20)27-24-26-16-18-14-17(15-25)23(32)31(22(18)28-24)21-4-2-3-5-21/h6-9,14,16,21H,2-5,10-13H2,1H3,(H,26,27,28) |
| InChIKey | VADOZMZXXRBXNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| narazaciclib (CHEBI:755127) has role antineoplastic agent (CHEBI:35610) |
| narazaciclib (CHEBI:755127) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| narazaciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| On-123300 | ChEMBL |
| On123300 | ChEMBL |
| Citations |
|---|