EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N8O2S |
| Net Charge | 0 |
| Average Mass | 386.441 |
| Monoisotopic Mass | 386.12734 |
| SMILES | NCC(=O)Nc1cncc(-c2nn3c(=O)cc(N4CCNCC4)nc3s2)c1 |
| InChI | InChI=1S/C16H18N8O2S/c17-7-13(25)20-11-5-10(8-19-9-11)15-22-24-14(26)6-12(21-16(24)27-15)23-3-1-18-2-4-23/h5-6,8-9,18H,1-4,7,17H2,(H,20,25) |
| InChIKey | LTVKZVGAALCRFW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zalunfiban (CHEBI:755125) has role cardiovascular drug (CHEBI:35554) |
| zalunfiban (CHEBI:755125) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| zalunfiban | WHO MedNet |
| Synonyms | Source |
|---|---|
| RUC-4 | ChEMBL |
| RUC4 | ChEMBL |
| Citations |
|---|