EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4O3 |
| Net Charge | 0 |
| Average Mass | 354.410 |
| Monoisotopic Mass | 354.16919 |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)Cc1nc(N2CCOCC2)cc(=O)n1 |
| InChI | InChI=1S/C19H22N4O3/c1-13-10-14-4-2-3-5-15(14)23(13)19(25)11-16-20-17(12-18(24)21-16)22-6-8-26-9-7-22/h2-5,12-13H,6-11H2,1H3,(H,20,21,24)/t13-/m0/s1 |
| InChIKey | UAXHPOBBKRWJGA-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sar-260301 (CHEBI:755122) has role antineoplastic agent (CHEBI:35610) |
| sar-260301 (CHEBI:755122) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Sar-260301 | ChEMBL |
| SAR260301 | ChEMBL |
| Citations |
|---|