EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O3 |
| Net Charge | 0 |
| Average Mass | 355.398 |
| Monoisotopic Mass | 355.16444 |
| SMILES | COc1ncnc(Cn2cc(C(=O)NCCO)c3ncc(C)cc32)c1C |
| InChI | InChI=1S/C18H21N5O3/c1-11-6-15-16(20-7-11)13(17(25)19-4-5-24)8-23(15)9-14-12(2)18(26-3)22-10-21-14/h6-8,10,24H,4-5,9H2,1-3H3,(H,19,25) |
| InChIKey | VDRYGTNDKXIPSK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tba-7371 (CHEBI:755120) has role antitubercular agent (CHEBI:33231) |
| tba-7371 (CHEBI:755120) is a N-acylethanolamine (CHEBI:52640) |
| Synonyms | Source |
|---|---|
| AZ-7371 | ChEMBL |
| TBA-7371 | ChEMBL |
| Citations |
|---|