EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25BrN4O2 |
| Net Charge | 0 |
| Average Mass | 457.372 |
| Monoisotopic Mass | 456.11609 |
| SMILES | COc1cc2ncnc3c2cc1OCCCCCN(C)Cc1ccc(Br)cc1N3 |
| InChI | InChI=1S/C22H25BrN4O2/c1-27-8-4-3-5-9-29-21-11-17-19(12-20(21)28-2)24-14-25-22(17)26-18-10-16(23)7-6-15(18)13-27/h6-7,10-12,14H,3-5,8-9,13H2,1-2H3,(H,24,25,26) |
| InChIKey | JXDYOSVKVSQGJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-26483327 (CHEBI:755119) has role antineoplastic agent (CHEBI:35610) |
| jnj-26483327 (CHEBI:755119) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| JNJ 26483327 | ChEMBL |
| JNJ-26483327 | ChEMBL |
| Citations |
|---|