EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10FN3 |
| Net Charge | 0 |
| Average Mass | 227.242 |
| Monoisotopic Mass | 227.08588 |
| SMILES | N#Cc1ccc([C@H]2CCc3cncn32)c(F)c1 |
| InChI | InChI=1S/C13H10FN3/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13/h1,3,5,7-8,13H,2,4H2/t13-/m1/s1 |
| InChIKey | USUZGMWDZDXMDG-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osilodrostat (CHEBI:755118) has role antihypertensive agent (CHEBI:35674) |
| osilodrostat (CHEBI:755118) has role renoprotective agent (CHEBI:231911) |
| osilodrostat (CHEBI:755118) is a benzenes (CHEBI:22712) |
| osilodrostat (CHEBI:755118) is a nitrile (CHEBI:18379) |
| Synonyms | Source |
|---|---|
| Lci-699 | ChEMBL |
| Lci699 | ChEMBL |
| LCI-699-NX | ChEMBL |
| LCI699-NX | ChEMBL |
| Osilodrostat | ChEMBL |
| Citations |
|---|