EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O6S2 |
| Net Charge | 0 |
| Average Mass | 406.526 |
| Monoisotopic Mass | 406.12323 |
| SMILES | C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)CCCC[C@@H]1CCSS1)C(=O)O |
| InChI | InChI=1S/C16H26N2O6S2/c1-10(16(23)24)17-15(22)12(6-7-14(20)21)18-13(19)5-3-2-4-11-8-9-25-26-11/h10-12H,2-9H2,1H3,(H,17,22)(H,18,19)(H,20,21)(H,23,24)/t10-,11+,12-/m0/s1 |
| InChIKey | MQXRTCVZPIHBLD-TUAOUCFPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cmx-2043 (CHEBI:755117) has role cardiovascular drug (CHEBI:35554) |
| cmx-2043 (CHEBI:755117) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Cmx-2043 | ChEMBL |
| Lip-ea | ChEMBL |
| R-lip-ea-oh | ChEMBL |
| (r)-lip-l-glu-l-ala-oh | ChEMBL |
| Citations |
|---|