EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17F3N8 |
| Net Charge | 0 |
| Average Mass | 414.395 |
| Monoisotopic Mass | 414.15283 |
| SMILES | Cc1nc(-c2cnn(C)c2-c2ccc(C(F)(F)F)cn2)c2c(N3CCC3)ncnn12 |
| InChI | InChI=1S/C19H17F3N8/c1-11-27-15(17-18(29-6-3-7-29)24-10-26-30(11)17)13-9-25-28(2)16(13)14-5-4-12(8-23-14)19(20,21)22/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | CLGCHUKGBICQTE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-05180999 (CHEBI:755112) has role antipsychotic agent (CHEBI:35476) |
| pf-05180999 (CHEBI:755112) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| PF-05180999 | ChEMBL |
| PF-999 | ChEMBL |
| Citations |
|---|