EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO3 |
| Net Charge | 0 |
| Average Mass | 313.397 |
| Monoisotopic Mass | 313.16779 |
| SMILES | [H][C@@]12CCN(C(=O)OC)[C@]1([H])CCC[C@@]2(O)C#Cc1cccc(C)c1 |
| InChI | InChI=1S/C19H23NO3/c1-14-5-3-6-15(13-14)8-11-19(22)10-4-7-17-16(19)9-12-20(17)18(21)23-2/h3,5-6,13,16-17,22H,4,7,9-10,12H2,1-2H3/t16-,17-,19-/m1/s1 |
| InChIKey | ZFPZEYHRWGMJCV-ZHALLVOQSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mavoglurant (CHEBI:755111) has role antiparkinson drug (CHEBI:48407) |
| mavoglurant (CHEBI:755111) has role renoprotective agent (CHEBI:231911) |
| mavoglurant (CHEBI:755111) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| mavoglurant | WHO MedNet |
| Synonyms | Source |
|---|---|
| AFQ-056 | ChEMBL |
| AFQ056 | ChEMBL |
| Citations |
|---|