EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O2S |
| Net Charge | 0 |
| Average Mass | 219.310 |
| Monoisotopic Mass | 219.10415 |
| SMILES | CC(=N)NCCSC[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C8H17N3O2S/c1-6(9)11-3-4-14-5-8(2,10)7(12)13/h3-5,10H2,1-2H3,(H2,9,11)(H,12,13)/t8-/m0/s1 |
| InChIKey | NWBJAUFHPXRBKI-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cindunistat (CHEBI:755101) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| cindunistat | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-00572986 | ChEMBL |
| PHA-84250 | ChEMBL |
| SC-084250 | ChEMBL |