EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13BrClNO7 |
| Net Charge | 0 |
| Average Mass | 422.615 |
| Monoisotopic Mass | 420.95639 |
| SMILES | [H][C@@]1(Oc2cnc3ccc(Br)c(Cl)c23)O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H13BrClNO7/c15-4-1-2-5-7(8(4)16)6(3-17-5)23-14-11(20)9(18)10(19)12(24-14)13(21)22/h1-3,9-12,14,17-20H,(H,21,22)/t9-,10-,11+,12-,14+/m0/s1 |
| InChIKey | DHJFFLKPAYHPHU-BYNIDDHOSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) has functional parent indoxyl (CHEBI:17840) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) has role chromogenic compound (CHEBI:75050) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) is a indolyl carbohydrate (CHEBI:24821) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) is a monosaccharide derivative (CHEBI:63367) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) is a organobromine compound (CHEBI:37141) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) is a organochlorine compound (CHEBI:36683) |
| 5-bromo-4-chloro-3-indolyl β-D-glucuronide (CHEBI:75510) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| 5-bromo-4-chloro-1H-indol-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 5-Bromo-4-chloro-3-indolylglucuronide | ChemIDplus |
| 5-bromo-4-chloroindoxyl β-D-glucuronide | ChEBI |
| Bci-3 glud | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US5358854 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1555937 | Reaxys |
| CAS:18656-89-8 | ChemIDplus |