EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N3O6.HCl |
| Net Charge | 0 |
| Average Mass | 515.994 |
| Monoisotopic Mass | 515.18231 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)Cc2ccccc2)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C26H29N3O6.ClH/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19;/h5-12,15,24,27H,13-14,16H2,1-4H3;1H |
| InChIKey | AIKVCUNQWYTVTO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicardipine hydrochloride (CHEBI:7551) has role geroprotector (CHEBI:176497) |
| nicardipine hydrochloride (CHEBI:7551) is a dihydropyridine (CHEBI:50075) |
| Synonyms | Source |
|---|---|
| Cardene (TN) | KEGG COMPOUND |
| Nicardipine hydrochloride | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07698 | KEGG COMPOUND |
| D00617 | KEGG DRUG |
| DBSALT000499 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:54527-84-3 | ChemIDplus |
| Citations |
|---|