EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N3O6.HCl |
| Net Charge | 0 |
| Average Mass | 515.994 |
| Monoisotopic Mass | 515.18231 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)Cc2ccccc2)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C26H29N3O6.ClH/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19;/h5-12,15,24,27H,13-14,16H2,1-4H3;1H |
| InChIKey | AIKVCUNQWYTVTO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicardipine hydrochloride (CHEBI:7551) has role antihypertensive agent (CHEBI:35674) |
| nicardipine hydrochloride (CHEBI:7551) has role antispasmodic drug (CHEBI:53784) |
| nicardipine hydrochloride (CHEBI:7551) has role cardiovascular drug (CHEBI:35554) |
| nicardipine hydrochloride (CHEBI:7551) has role geroprotector (CHEBI:176497) |
| nicardipine hydrochloride (CHEBI:7551) is a dihydropyridine (CHEBI:50075) |
| Synonyms | Source |
|---|---|
| Barizin | ChEMBL |
| Cardene (TN) | KEGG COMPOUND |
| Cardepine | ChEMBL |
| Dacarel | ChEMBL |
| Lecibra | ChEMBL |
| Lecibral | ChEMBL |
| Brand Names | Source |
|---|---|
| Cardene | ChEMBL |
| Cardene sr | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C07698 | KEGG COMPOUND |
| D00617 | KEGG DRUG |
| DBSALT000499 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:54527-84-3 | ChemIDplus |
| Citations |
|---|