EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21ClFN3O4S |
| Net Charge | 0 |
| Average Mass | 441.912 |
| Monoisotopic Mass | 441.09253 |
| SMILES | Cc1c(F)cccc1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)[C@H]2CCCNC2)c1O |
| InChI | InChI=1S/C19H21ClFN3O4S/c1-11-14(21)5-2-6-15(11)23-19(26)24-16-8-7-13(20)18(17(16)25)29(27,28)12-4-3-9-22-10-12/h2,5-8,12,22,25H,3-4,9-10H2,1H3,(H2,23,24,26)/t12-/m0/s1 |
| InChIKey | NGYNBSHYFOFVLS-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danirixin (CHEBI:755075) has role antiviral agent (CHEBI:22587) |
| danirixin (CHEBI:755075) is a ureas (CHEBI:47857) |
| INNs | Source |
|---|---|
| danirixin | WHO MedNet |
| danirixina | WHO MedNet |
| danirixine | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK1325756 | ChEMBL |
| GSK-1325756B | ChEMBL |
| GSK1325756B | ChEMBL |
| Citations |
|---|