EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N2O3 |
| Net Charge | 0 |
| Average Mass | 438.612 |
| Monoisotopic Mass | 438.28824 |
| SMILES | CCC[C@@H](N(NC(=O)c1cccc(OC)c1CC)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C27H38N2O3/c1-9-12-24(27(5,6)7)29(26(31)20-16-18(3)15-19(4)17-20)28-25(30)22-13-11-14-23(32-8)21(22)10-2/h11,13-17,24H,9-10,12H2,1-8H3,(H,28,30)/t24-/m1/s1 |
| InChIKey | LZWZPGLVHLSWQX-XMMPIXPASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| veledimex (CHEBI:755070) has role antineoplastic agent (CHEBI:35610) |
| veledimex (CHEBI:755070) is a benzoic acids (CHEBI:22723) |
| INN | Source |
|---|---|
| veledimex | WHO MedNet |
| Synonyms | Source |
|---|---|
| INXN-1001 | ChEMBL |
| RG-115932 | ChEMBL |