EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H48N8O6S2 |
| Net Charge | 0 |
| Average Mass | 885.085 |
| Monoisotopic Mass | 884.31382 |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc2ccc(-c3csc4c(-c5ccc(-c6cnc([C@@H]7CCCN7C(=O)[C@H](NC(=O)OC)c7ccccc7)n6)cc5)csc34)cc2n1)C(C)C |
| InChI | InChI=1S/C47H48N8O6S2/c1-26(2)38(52-46(58)60-3)44(56)55-21-9-13-37(55)43-49-33-19-18-30(22-34(33)50-43)32-25-63-40-31(24-62-41(32)40)27-14-16-28(17-15-27)35-23-48-42(51-35)36-12-8-20-54(36)45(57)39(53-47(59)61-4)29-10-6-5-7-11-29/h5-7,10-11,14-19,22-26,36-39H,8-9,12-13,20-21H2,1-4H3,(H,48,51)(H,49,50)(H,52,58)(H,53,59)/t36-,37-,38-,39+/m0/s1 |
| InChIKey | ATOLIHZIXHZSBA-BTSKBWHGSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| samatasvir (CHEBI:755068) has role antiviral agent (CHEBI:22587) |
| samatasvir (CHEBI:755068) is a valine derivative (CHEBI:27267) |
| INN | Source |
|---|---|
| samatasvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| IDX-18719 | ChEMBL |
| IDX18719 | ChEMBL |
| Citations |
|---|