EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45N3O7S2 |
| Net Charge | 0 |
| Average Mass | 695.904 |
| Monoisotopic Mass | 695.26989 |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)NCC(=O)O)c3ccccc3)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C36H45N3O7S2/c1-4-6-18-36(19-7-5-2)24-39(27-16-12-9-13-17-27)28-20-30(47-3)29(21-31(28)48(44,45)25-36)46-23-32(40)38-34(26-14-10-8-11-15-26)35(43)37-22-33(41)42/h8-17,20-21,34H,4-7,18-19,22-25H2,1-3H3,(H,37,43)(H,38,40)(H,41,42)/t34-/m1/s1 |
| InChIKey | XFLQIRAKKLNXRQ-UUWRZZSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elobixibat (CHEBI:755066) has role laxative (CHEBI:50503) |
| elobixibat (CHEBI:755066) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| A-3309 | ChEMBL |
| A3309 | ChEMBL |
| AZD-7806 | ChEMBL |
| AZD7806 | ChEMBL |
| Elobixibat | ChEMBL |