EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O3S.C32H34N4O6 |
| Net Charge | 0 |
| Average Mass | 742.851 |
| Monoisotopic Mass | 742.26725 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(CC1CC1)[C@]([H])(C4)[C@]3(O)CC(C(=O)NC(C)(C)c1nc(-c3ccccc3)no1)=C2O |
| InChI | InChI=1S/C32H34N4O6.C7H8O3S/c1-30(2,29-33-27(35-42-29)18-6-4-3-5-7-18)34-28(39)20-15-32(40)22-14-19-10-11-21(37)25-23(19)31(32,26(41-25)24(20)38)12-13-36(22)16-17-8-9-17;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,10-11,17,22,26,37-38,40H,8-9,12-16H2,1-2H3,(H,34,39);2-5H,1H3,(H,8,9,10)/t22-,26+,31+,32-;/m1./s1 |
| InChIKey | WCYDLROFMZJJLE-RTMHEQJQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naldemedine tosylate (CHEBI:755061) has role laxative (CHEBI:50503) |
| naldemedine tosylate (CHEBI:755061) is a morphinane alkaloid (CHEBI:25418) |
| Synonyms | Source |
|---|---|
| Naldemedine tosilate | ChEMBL |
| Naldemedine tosylate | ChEMBL |
| Brand Names | Source |
|---|---|
| Rizmoic | ChEMBL |
| Symproic | ChEMBL |