EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755058 - lomibuvir
| Formula | C25H35NO4S |
| Net Charge | 0 |
| Average Mass | 445.625 |
| Monoisotopic Mass | 445.22868 |
| SMILES | CC(C)(C)C#Cc1cc(N(C(=O)[C@H]2CC[C@H](C)CC2)[C@H]2CC[C@H](O)CC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C25H35NO4S/c1-16-5-7-17(8-6-16)23(28)26(18-9-11-19(27)12-10-18)21-15-20(13-14-25(2,3)4)31-22(21)24(29)30/h15-19,27H,5-12H2,1-4H3,(H,29,30)/t16-,17-,18-,19- |
| InChIKey | WPMJNLCLKAKMLA-VVPTUSLJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lomibuvir (CHEBI:755058) has role antiviral agent (CHEBI:22587) |
| lomibuvir (CHEBI:755058) is a thiophenecarboxylic acid (CHEBI:48436) |
| INN | Source |
|---|---|
| lomibuvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| Vch-222 | ChEMBL |
| VX-222 | ChEMBL |
| Citations |
|---|