EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N5O3S |
| Net Charge | 0 |
| Average Mass | 491.617 |
| Monoisotopic Mass | 491.19911 |
| SMILES | CCc1nc2c(C)nc(C)cc2n1-c1ccc(CCNC(=O)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H29N5O3S/c1-5-24-29-25-19(4)28-18(3)16-23(25)31(24)21-10-8-20(9-11-21)14-15-27-26(32)30-35(33,34)22-12-6-17(2)7-13-22/h6-13,16H,5,14-15H2,1-4H3,(H2,27,30,32) |
| InChIKey | HZVLFTCYCLXTGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| grapiprant (CHEBI:755055) has role antineoplastic agent (CHEBI:35610) |
| grapiprant (CHEBI:755055) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| 423 | ChEMBL |
| AAT-007 | ChEMBL |
| CJ-023 | ChEMBL |
| Cj-023,423 | ChEMBL |
| CJ 023423 | ChEMBL |
| CJ-023423 | ChEMBL |
| Brand Name | Source |
|---|---|
| Galliprant | ChEMBL |
| Citations |
|---|